C11H27NO6P2 — CID 53321690
[2-[methyl(octyl)amino]-1-phosphonoethyl]phosphonic acid (PubChem CID 53321690) has the molecular formula C11H27NO6P2 and a molecular weight of 331.29 g/mol. Its IUPAC name is [2-[methyl(octyl)amino]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[methyl(octyl)amino]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 53321690 |
| Molecular Formula | C11H27NO6P2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [2-[methyl(octyl)amino]-1-phosphonoethyl]phosphonic acid |
| SMILES | CCCCCCCCN(C)CC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C11H27NO6P2/c1-3-4-5-6-7-8-9-12(2)10-11(19(13,14)15)20(16,17)18/h11H,3-10H2,1-2H3,(H2,13,14,15)(H2,16,17,18) |
| InChIKey | QHCZJADGLCZUHQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|