C17H14N2O2 — CID 53322380
1-[6-(2-phenylethynyl)-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]ethanone (PubChem CID 53322380) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-[6-(2-phenylethynyl)-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]ethanone.
| Compound Name | 1-[6-(2-phenylethynyl)-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]ethanone |
|---|---|
| PubChem CID | 53322380 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-[6-(2-phenylethynyl)-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCOc2nc(C#Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H14N2O2/c1-13(20)19-11-12-21-17-16(19)10-9-15(18-17)8-7-14-5-3-2-4-6-14/h2-6,9-10H,11-12H2,1H3 |
| InChIKey | ZQKDRKYFMGXQPZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|