C18H12ClF3O3 — CID 53323101
6-chloro-8-(4-methylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 53323101) has the molecular formula C18H12ClF3O3 and a molecular weight of 368.74 g/mol. Its IUPAC name is 6-chloro-8-(4-methylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-(4-methylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 53323101 |
| Molecular Formula | C18H12ClF3O3 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 6-chloro-8-(4-methylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(Cl)cc3c2OC(C(F)(F)F)C(C(=O)O)=C3)cc1 |
| InChI | InChI=1S/C18H12ClF3O3/c1-9-2-4-10(5-3-9)13-8-12(19)6-11-7-14(17(23)24)16(18(20,21)22)25-15(11)13/h2-8,16H,1H3,(H,23,24) |
| InChIKey | FKRGMKAZITYKGR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |