C10H10ClN5 — CID 53323136
7-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)indazol-1-amine (PubChem CID 53323136) has the molecular formula C10H10ClN5 and a molecular weight of 235.68 g/mol. Its IUPAC name is 7-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)indazol-1-amine.
| Compound Name | 7-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)indazol-1-amine |
|---|---|
| PubChem CID | 53323136 |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.68 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 7-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)indazol-1-amine |
| SMILES | Clc1cccc2cnn(NC3=NCCN3)c12 |
| InChI | InChI=1S/C10H10ClN5/c11-8-3-1-2-7-6-14-16(9(7)8)15-10-12-4-5-13-10/h1-3,6H,4-5H2,(H2,12,13,15) |
| InChIKey | QANNWEVJDHKTEL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.68 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |