C24H37NO — CID 53324039
(4Z,7Z,10Z,12Z,15Z,18Z)-N-propan-2-ylhenicosa-4,7,10,12,15,18-hexaenamide (PubChem CID 53324039) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is (4Z,7Z,10Z,12Z,15Z,18Z)-N-propan-2-ylhenicosa-4,7,10,12,15,18-hexaenamide.
| Compound Name | (4Z,7Z,10Z,12Z,15Z,18Z)-N-propan-2-ylhenicosa-4,7,10,12,15,18-hexaenamide |
|---|---|
| PubChem CID | 53324039 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | (4Z,7Z,10Z,12Z,15Z,18Z)-N-propan-2-ylhenicosa-4,7,10,12,15,18-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C=C/C/C=C\C/C=C\CCC(=O)NC(C)C |
| InChI | InChI=1S/C24H37NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(26)25-23(2)3/h5-6,8-9,11-14,16-17,19-20,23H,4,7,10,15,18,21-22H2,1-3H3,(H,25,26)/b6-5-,9-8-,12-11-,14-13-,17-16-,20-19- |
| InChIKey | IAWCXTZGAPEZON-VEWWNFFNSA-N |
| XLogP | 6.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|