C19H14ClF3O3 — CID 53324454
6-chloro-8-(4-ethylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 53324454) has the molecular formula C19H14ClF3O3 and a molecular weight of 382.77 g/mol. Its IUPAC name is 6-chloro-8-(4-ethylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-(4-ethylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 53324454 |
| Molecular Formula | C19H14ClF3O3 |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 6-chloro-8-(4-ethylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCc1ccc(-c2cc(Cl)cc3c2OC(C(F)(F)F)C(C(=O)O)=C3)cc1 |
| InChI | InChI=1S/C19H14ClF3O3/c1-2-10-3-5-11(6-4-10)14-9-13(20)7-12-8-15(18(24)25)17(19(21,22)23)26-16(12)14/h3-9,17H,2H2,1H3,(H,24,25) |
| InChIKey | IEWFZNLCMANOLT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |