C15H15FN2O5 — CID 53327290
5-[(4-fluorophenyl)-hydroxymethyl]-N,3-dihydroxy-4-(hydroxymethyl)-N-methylpyridine-2-carboxamide (PubChem CID 53327290) has the molecular formula C15H15FN2O5 and a molecular weight of 322.29 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)-hydroxymethyl]-N,3-dihydroxy-4-(hydroxymethyl)-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[(4-fluorophenyl)-hydroxymethyl]-N,3-dihydroxy-4-(hydroxymethyl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 53327290 |
| Molecular Formula | C15H15FN2O5 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5-[(4-fluorophenyl)-hydroxymethyl]-N,3-dihydroxy-4-(hydroxymethyl)-N-methylpyridine-2-carboxamide |
| SMILES | CN(O)C(=O)c1ncc(C(O)c2ccc(F)cc2)c(CO)c1O |
| InChI | InChI=1S/C15H15FN2O5/c1-18(23)15(22)12-14(21)11(7-19)10(6-17-12)13(20)8-2-4-9(16)5-3-8/h2-6,13,19-21,23H,7H2,1H3 |
| InChIKey | OESBHQRQTVAGNC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|