C24H27F6N3O5 — CID 53328074
(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 53328074) has the molecular formula C24H27F6N3O5 and a molecular weight of 551.48 g/mol. Its IUPAC name is (R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 53328074 |
| Molecular Formula | C24H27F6N3O5 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | (R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](N)c1ccnc2ccc(OC)cc12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H25N3O.2C2HF3O2/c1-3-13-12-23-9-7-14(13)10-19(23)20(21)16-6-8-22-18-5-4-15(24-2)11-17(16)18;2*3-2(4,5)1(6)7/h3-6,8,11,13-14,19-20H,1,7,9-10,12,21H2,2H3;2*(H,6,7)/t13-,14-,19+,20+;;/m0../s1 |
| InChIKey | NNTMWKCJJYZSQO-FPYWIVBFSA-N |
| XLogP | 4.41 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|