C22H20FNO4 — CID 53328518
4-fluoro-N-[[4-[6-(4-methylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl]aniline (PubChem CID 53328518) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is 4-fluoro-N-[[4-[6-(4-methylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl]aniline.
| Compound Name | 4-fluoro-N-[[4-[6-(4-methylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 53328518 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-fluoro-N-[[4-[6-(4-methylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl]aniline |
| SMILES | Cc1ccc(C2OOC(c3ccc(CNc4ccc(F)cc4)cc3)OO2)cc1 |
| InChI | InChI=1S/C22H20FNO4/c1-15-2-6-17(7-3-15)21-25-27-22(28-26-21)18-8-4-16(5-9-18)14-24-20-12-10-19(23)11-13-20/h2-13,21-22,24H,14H2,1H3 |
| InChIKey | QGPAWMUJIJKXKL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|