C23H23NO4 — CID 53328328
3-methyl-N-[[4-[6-(4-methylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl]aniline (PubChem CID 53328328) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-methyl-N-[[4-[6-(4-methylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl]aniline.
| Compound Name | 3-methyl-N-[[4-[6-(4-methylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 53328328 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-methyl-N-[[4-[6-(4-methylphenyl)-1,2,4,5-tetraoxan-3-yl]phenyl]methyl]aniline |
| SMILES | Cc1ccc(C2OOC(c3ccc(CNc4cccc(C)c4)cc3)OO2)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-16-6-10-19(11-7-16)22-25-27-23(28-26-22)20-12-8-18(9-13-20)15-24-21-5-3-4-17(2)14-21/h3-14,22-24H,15H2,1-2H3 |
| InChIKey | CXXBYWXVEFCRND-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|