C10H8ClN3O — CID 53328621
3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-one (PubChem CID 53328621) has the molecular formula C10H8ClN3O and a molecular weight of 221.65 g/mol. Its IUPAC name is 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-one.
| Compound Name | 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-one |
|---|---|
| PubChem CID | 53328621 |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-one |
| SMILES | O=C1CC(c2ncc3c(Cl)nccn23)C1 |
| InChI | InChI=1S/C10H8ClN3O/c11-9-8-5-13-10(6-3-7(15)4-6)14(8)2-1-12-9/h1-2,5-6H,3-4H2 |
| InChIKey | WXMBSVUDSOHVNL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |