C26H25N5O2 — CID 53332047
11-(4-butoxyphenyl)-4-[(4-ethenylphenyl)methyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,7,10-tetraen-5-one (PubChem CID 53332047) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 11-(4-butoxyphenyl)-4-[(4-ethenylphenyl)methyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,7,10-tetraen-5-one.
| Compound Name | 11-(4-butoxyphenyl)-4-[(4-ethenylphenyl)methyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,7,10-tetraen-5-one |
|---|---|
| PubChem CID | 53332047 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 11-(4-butoxyphenyl)-4-[(4-ethenylphenyl)methyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,7,10-tetraen-5-one |
| SMILES | C=Cc1ccc(Cn2nc3c4cc(-c5ccc(OCCCC)cc5)nn4ccn3c2=O)cc1 |
| InChI | InChI=1S/C26H25N5O2/c1-3-5-16-33-22-12-10-21(11-13-22)23-17-24-25-28-31(18-20-8-6-19(4-2)7-9-20)26(32)29(25)14-15-30(24)27-23/h4,6-15,17H,2-3,5,16,18H2,1H3 |
| InChIKey | UDXWYMZTXNPEAA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|