C23H28N6O3 — CID 95184702
N-[(2S)-butan-2-yl]-2-[11-(4-butoxyphenyl)-5-oxo-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,7,10-tetraen-4-yl]acetamide (PubChem CID 95184702) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-[11-(4-butoxyphenyl)-5-oxo-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,7,10-tetraen-4-yl]acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-[11-(4-butoxyphenyl)-5-oxo-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,7,10-tetraen-4-yl]acetamide |
|---|---|
| PubChem CID | 95184702 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-[11-(4-butoxyphenyl)-5-oxo-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,7,10-tetraen-4-yl]acetamide |
| SMILES | CCCCOc1ccc(-c2cc3c4nn(CC(=O)N[C@@H](C)CC)c(=O)n4ccn3n2)cc1 |
| InChI | InChI=1S/C23H28N6O3/c1-4-6-13-32-18-9-7-17(8-10-18)19-14-20-22-26-29(15-21(30)24-16(3)5-2)23(31)27(22)11-12-28(20)25-19/h7-12,14,16H,4-6,13,15H2,1-3H3,(H,24,30)/t16-/m0/s1 |
| InChIKey | POZCLJJZLNVYAH-INIZCTEOSA-N |
| XLogP | 2.90 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|