C19H24N4O3 — CID 53335594
N-(2-methoxyethyl)-4-(3-piperidin-1-ylpyrazin-2-yl)oxybenzamide (PubChem CID 53335594) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(3-piperidin-1-ylpyrazin-2-yl)oxybenzamide.
| Compound Name | N-(2-methoxyethyl)-4-(3-piperidin-1-ylpyrazin-2-yl)oxybenzamide |
|---|---|
| PubChem CID | 53335594 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-(2-methoxyethyl)-4-(3-piperidin-1-ylpyrazin-2-yl)oxybenzamide |
| SMILES | COCCNC(=O)c1ccc(Oc2nccnc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-25-14-11-21-18(24)15-5-7-16(8-6-15)26-19-17(20-9-10-22-19)23-12-3-2-4-13-23/h5-10H,2-4,11-14H2,1H3,(H,21,24) |
| InChIKey | TWVPECRJWSUCRK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|