C14H11FN2O3 — CID 5333882
N-[(E)-(2-fluorophenyl)methylideneamino]-2,4-dihydroxybenzamide (PubChem CID 5333882) has the molecular formula C14H11FN2O3 and a molecular weight of 274.25 g/mol. Its IUPAC name is N-[(E)-(2-fluorophenyl)methylideneamino]-2,4-dihydroxybenzamide.
| Compound Name | N-[(E)-(2-fluorophenyl)methylideneamino]-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 5333882 |
| Molecular Formula | C14H11FN2O3 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-[(E)-(2-fluorophenyl)methylideneamino]-2,4-dihydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccccc1F)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H11FN2O3/c15-12-4-2-1-3-9(12)8-16-17-14(20)11-6-5-10(18)7-13(11)19/h1-8,18-19H,(H,17,20)/b16-8+ |
| InChIKey | ZAVJXEMUKJBCGF-LZYBPNLTSA-N |
| XLogP | 2.00 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|