C19H16FN3O3 — CID 169088186
N-[(E)-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-2,4-dihydroxybenzamide (PubChem CID 169088186) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is N-[(E)-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-2,4-dihydroxybenzamide.
| Compound Name | N-[(E)-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 169088186 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[(E)-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-2,4-dihydroxybenzamide |
| SMILES | O=C(N/N=C/c1cccn1Cc1ccccc1F)c1ccc(O)cc1O |
| InChI | InChI=1S/C19H16FN3O3/c20-17-6-2-1-4-13(17)12-23-9-3-5-14(23)11-21-22-19(26)16-8-7-15(24)10-18(16)25/h1-11,24-25H,12H2,(H,22,26)/b21-11+ |
| InChIKey | XUEPGLTWYKWFBN-SRZZPIQSSA-N |
| XLogP | 2.85 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|