C20H16F3N3O3 — CID 169088183
3,5-dihydroxy-N-[(E)-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methylideneamino]benzamide (PubChem CID 169088183) has the molecular formula C20H16F3N3O3 and a molecular weight of 403.36 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(E)-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methylideneamino]benzamide.
| Compound Name | 3,5-dihydroxy-N-[(E)-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 169088183 |
| Molecular Formula | C20H16F3N3O3 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3,5-dihydroxy-N-[(E)-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cccn1Cc1ccc(C(F)(F)F)cc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C20H16F3N3O3/c21-20(22,23)15-5-3-13(4-6-15)12-26-7-1-2-16(26)11-24-25-19(29)14-8-17(27)10-18(28)9-14/h1-11,27-28H,12H2,(H,25,29)/b24-11+ |
| InChIKey | SOZDWOQTXBSBEV-BHGWPJFGSA-N |
| XLogP | 3.73 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|