C14H15ClF3N5 — CID 137246469
(E)-(diaminomethylideneamino)-[[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methylidene]azanium chloride (PubChem CID 137246469) has the molecular formula C14H15ClF3N5 and a molecular weight of 345.76 g/mol. Its IUPAC name is (E)-(diaminomethylideneamino)-[[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methylidene]azanium chloride.
| Compound Name | (E)-(diaminomethylideneamino)-[[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methylidene]azanium chloride |
|---|---|
| PubChem CID | 137246469 |
| Molecular Formula | C14H15ClF3N5 |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (E)-(diaminomethylideneamino)-[[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methylidene]azanium chloride |
| SMILES | NC(N)=N/[NH+]=C/c1cccn1Cc1ccc(C(F)(F)F)cc1.[Cl-] |
| InChI | InChI=1S/C14H14F3N5.ClH/c15-14(16,17)11-5-3-10(4-6-11)9-22-7-1-2-12(22)8-20-21-13(18)19;/h1-8H,9H2,(H4,18,19,21);1H/b20-8+; |
| InChIKey | BXCUINRHANJQSD-MAFYXNADSA-N |
| XLogP | -2.75 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|