C30H51FN4O6 — CID 53339603
(2S,4S,5S,7R)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-N'-[3-fluoro-2-(3-methoxypropoxy)phenyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide (PubChem CID 53339603) has the molecular formula C30H51FN4O6 and a molecular weight of 582.76 g/mol. Its IUPAC name is (2S,4S,5S,7R)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-N'-[3-fluoro-2-(3-methoxypropoxy)phenyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide.
| Compound Name | (2S,4S,5S,7R)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-N'-[3-fluoro-2-(3-methoxypropoxy)phenyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide |
|---|---|
| PubChem CID | 53339603 |
| Molecular Formula | C30H51FN4O6 |
| Molecular Weight | 582.76 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | (2S,4S,5S,7R)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-N'-[3-fluoro-2-(3-methoxypropoxy)phenyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide |
| SMILES | COCCCOc1c(F)cccc1NC(=O)C[C@@H](C[C@H](N)[C@@H](O)CC(C(=O)NCC(C)(C)C(N)=O)C(C)C)C(C)C |
| InChI | InChI=1S/C30H51FN4O6/c1-18(2)20(15-26(37)35-24-11-8-10-22(31)27(24)41-13-9-12-40-7)14-23(32)25(36)16-21(19(3)4)28(38)34-17-30(5,6)29(33)39/h8,10-11,18-21,23,25,36H,9,12-17,32H2,1-7H3,(H2,33,39)(H,34,38)(H,35,37)/t20-,21?,23+,25+/m1/s1 |
| InChIKey | YDLQZXCRKNNCPR-BZXIPLQISA-N |
| XLogP | 3.21 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|