About N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide
N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide (PubChem CID 5333975) has the molecular formula C20H18N2O2
and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[2-[(E)-2-(8-hydroxy-5-methylquinolin-2-yl)ethenyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide |
| PubChem CID | 5333975 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[2-[(E)-2-(8-hydroxy-5-methylquinolin-2-yl)ethenyl]phenyl]acetamide |
| SMILES | CC1=C2C=CC(=NC2=C(C=C1)O)/C=C/C3=CC=CC=C3NC(=O)C |
| InChI | InChI=1S/C20H18N2O2/c1-13-7-12-19(24)20-17(13)11-10-16(22-20)9-8-15-5-3-4-6-18(15)21-14(2)23/h3-12,24H,1-2H3,(H,21,23)/b9-8+ |
| InChIKey | UDPDZUOFMXSVGK-CMDGGOBGSA-N |
| XLogP | 3.70 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | 465 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide?
The IUPAC name of N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide (CID 5333975) is N-[2-[(E)-2-(8-hydroxy-5-methylquinolin-2-yl)ethenyl]phenyl]acetamide.
What is the SMILES notation for N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide?
The canonical SMILES for N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide is CC1=C2C=CC(=NC2=C(C=C1)O)/C=C/C3=CC=CC=C3NC(=O)C.
What is the InChIKey of N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide?
The InChIKey is UDPDZUOFMXSVGK-CMDGGOBGSA-N. The full InChI is InChI=1S/C20H18N2O2/c1-13-7-12-19(24)20-17(13)11-10-16(22-20)9-8-15-5-3-4-6-18(15)21-14(2)23/h3-12,24H,1-2H3,(H,21,23)/b9-8+.
What are the key properties of N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide?
N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide has a molecular weight of 318.40 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-{2-[2-(8-hydroxy-5-methyl-2-quinolinyl)vinyl]phenyl}acetamide is sourced from PubChem (CID 5333975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).