C28H30F2N2O4 — CID 53340548
4-[bis(3-fluorophenyl)-hydroxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-N-methylbenzamide (PubChem CID 53340548) has the molecular formula C28H30F2N2O4 and a molecular weight of 496.55 g/mol. Its IUPAC name is 4-[bis(3-fluorophenyl)-hydroxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-N-methylbenzamide.
| Compound Name | 4-[bis(3-fluorophenyl)-hydroxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 53340548 |
| Molecular Formula | C28H30F2N2O4 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 4-[bis(3-fluorophenyl)-hydroxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-N-methylbenzamide |
| SMILES | CN(CCCCCCC(=O)NO)C(=O)c1ccc(C(O)(c2cccc(F)c2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C28H30F2N2O4/c1-32(17-5-3-2-4-12-26(33)31-36)27(34)20-13-15-21(16-14-20)28(35,22-8-6-10-24(29)18-22)23-9-7-11-25(30)19-23/h6-11,13-16,18-19,35-36H,2-5,12,17H2,1H3,(H,31,33) |
| InChIKey | KITAZNKMPXCMAF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|