C35H37BN2O2S2 — CID 53342100
12,12-diethyl-10,14-bis(5-ethylthiophen-2-yl)-7,17-dimethoxy-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene (PubChem CID 53342100) has the molecular formula C35H37BN2O2S2 and a molecular weight of 592.64 g/mol. Its IUPAC name is 12,12-diethyl-10,14-bis(5-ethylthiophen-2-yl)-7,17-dimethoxy-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene.
| Compound Name | 12,12-diethyl-10,14-bis(5-ethylthiophen-2-yl)-7,17-dimethoxy-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene |
|---|---|
| PubChem CID | 53342100 |
| Molecular Formula | C35H37BN2O2S2 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 12,12-diethyl-10,14-bis(5-ethylthiophen-2-yl)-7,17-dimethoxy-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene |
| SMILES | CCc1ccc(C2=[N+]3C(=Cc4c5ccc(OC)cc5c(-c5ccc(CC)s5)n4[B-]3(CC)CC)c3ccc(OC)cc32)s1 |
| InChI | InChI=1S/C35H37BN2O2S2/c1-7-24-13-17-32(41-24)34-28-19-22(39-5)11-15-26(28)30-21-31-27-16-12-23(40-6)20-29(27)35(33-18-14-25(8-2)42-33)38(31)36(9-3,10-4)37(30)34/h11-21H,7-10H2,1-6H3 |
| InChIKey | YEXBGOTULWLRGY-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|