C31H27F2N2O2S3+ — CID 155790097
10,14-bis(5-ethylthiophen-2-yl)-12,12-difluoro-7,17-dimethoxy-12λ4-thia-13-aza-11-azoniapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene (PubChem CID 155790097) has the molecular formula C31H27F2N2O2S3+ and a molecular weight of 593.77 g/mol. Its IUPAC name is 10,14-bis(5-ethylthiophen-2-yl)-12,12-difluoro-7,17-dimethoxy-12λ4-thia-13-aza-11-azoniapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene.
| Compound Name | 10,14-bis(5-ethylthiophen-2-yl)-12,12-difluoro-7,17-dimethoxy-12λ4-thia-13-aza-11-azoniapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene |
|---|---|
| PubChem CID | 155790097 |
| Molecular Formula | C31H27F2N2O2S3+ |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.12 |
| IUPAC Name | 10,14-bis(5-ethylthiophen-2-yl)-12,12-difluoro-7,17-dimethoxy-12λ4-thia-13-aza-11-azoniapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene |
| SMILES | CCc1ccc(C2=[N+]3C(=Cc4c5ccc(OC)cc5c(-c5ccc(CC)s5)n4S3(F)F)c3ccc(OC)cc32)s1 |
| InChI | InChI=1S/C31H27F2N2O2S3/c1-5-20-9-13-28(38-20)30-24-15-18(36-3)7-11-22(24)26-17-27-23-12-8-19(37-4)16-25(23)31(29-14-10-21(6-2)39-29)35(27)40(32,33)34(26)30/h7-17H,5-6H2,1-4H3/q+1 |
| InChIKey | ZDBKQZUGEBTEIS-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|