C36H29F6NO2S — CID 139645994
3-[3,3,4,4,5,5-hexafluoro-2-[6-[4-(4-methoxyphenyl)buta-1,3-dienyl]-2-methyl-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole (PubChem CID 139645994) has the molecular formula C36H29F6NO2S and a molecular weight of 653.69 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[6-[4-(4-methoxyphenyl)buta-1,3-dienyl]-2-methyl-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[6-[4-(4-methoxyphenyl)buta-1,3-dienyl]-2-methyl-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 139645994 |
| Molecular Formula | C36H29F6NO2S |
| Molecular Weight | 653.69 g/mol |
| Exact Mass | 653.18 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[6-[4-(4-methoxyphenyl)buta-1,3-dienyl]-2-methyl-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
| SMILES | COc1ccc(C=CC=Cc2ccc3c(C4=C(c5c(C)n(C)c6ccc(OC)cc56)C(F)(F)C(F)(F)C4(F)F)c(C)sc3c2)cc1 |
| InChI | InChI=1S/C36H29F6NO2S/c1-20-30(27-19-25(45-5)15-17-28(27)43(20)3)32-33(35(39,40)36(41,42)34(32,37)38)31-21(2)46-29-18-23(12-16-26(29)31)9-7-6-8-22-10-13-24(44-4)14-11-22/h6-19H,1-5H3 |
| InChIKey | FFLOLERMERAPOX-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.69 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|