C20H24FNO — CID 53342189
(1R,2R,6R)-2-(dibenzylamino)-6-fluorocyclohexan-1-ol (PubChem CID 53342189) has the molecular formula C20H24FNO and a molecular weight of 313.42 g/mol. Its IUPAC name is (1R,2R,6R)-2-(dibenzylamino)-6-fluorocyclohexan-1-ol.
| Compound Name | (1R,2R,6R)-2-(dibenzylamino)-6-fluorocyclohexan-1-ol |
|---|---|
| PubChem CID | 53342189 |
| Molecular Formula | C20H24FNO |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (1R,2R,6R)-2-(dibenzylamino)-6-fluorocyclohexan-1-ol |
| SMILES | O[C@H]1[C@H](F)CCC[C@H]1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H24FNO/c21-18-12-7-13-19(20(18)23)22(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-6,8-11,18-20,23H,7,12-15H2/t18-,19-,20+/m1/s1 |
| InChIKey | HNRDHQUOZYMQAQ-AQNXPRMDSA-N |
| XLogP | 3.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |