About methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate
methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate (PubChem CID 53342314) has the molecular formula C15H30O3Si
and a molecular weight of 286.49 g/mol. Its IUPAC name is methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate.
Molecular Properties
| Compound Name | methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate |
| PubChem CID | 53342314 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)CC(C)(C)C(=O)OC |
| InChI | InChI=1S/C15H30O3Si/c1-12(10-15(5,6)13(16)17-7)11-18-19(8,9)14(2,3)4/h1,10-11H2,2-9H3 |
| InChIKey | ASZFVDWAOOQLET-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate?
The IUPAC name of methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate (CID 53342314) is methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate.
What is the SMILES notation for methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate?
The canonical SMILES for methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate is C=C(CO[Si](C)(C)C(C)(C)C)CC(C)(C)C(=O)OC.
What is the InChIKey of methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate?
The InChIKey is ASZFVDWAOOQLET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3Si/c1-12(10-15(5,6)13(16)17-7)11-18-19(8,9)14(2,3)4/h1,10-11H2,2-9H3.
What are the key properties of methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate?
methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate has a molecular weight of 286.49 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpent-4-enoate is sourced from PubChem (CID 53342314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).