C12H12O3 — CID 53342924
3-but-3-en-1-ynyl-4,4-dimethoxycyclohexa-2,5-dien-1-one (PubChem CID 53342924) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 3-but-3-en-1-ynyl-4,4-dimethoxycyclohexa-2,5-dien-1-one.
| Compound Name | 3-but-3-en-1-ynyl-4,4-dimethoxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 53342924 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 3-but-3-en-1-ynyl-4,4-dimethoxycyclohexa-2,5-dien-1-one |
| SMILES | C=CC#CC1=CC(=O)C=CC1(OC)OC |
| InChI | InChI=1S/C12H12O3/c1-4-5-6-10-9-11(13)7-8-12(10,14-2)15-3/h4,7-9H,1H2,2-3H3 |
| InChIKey | KWSLRFCWZBSULS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|