C17H18O3 — CID 53342925
(1R,2S,7R,8S)-5-but-3-en-1-ynyl-6,6-dimethoxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one (PubChem CID 53342925) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (1R,2S,7R,8S)-5-but-3-en-1-ynyl-6,6-dimethoxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one.
| Compound Name | (1R,2S,7R,8S)-5-but-3-en-1-ynyl-6,6-dimethoxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
|---|---|
| PubChem CID | 53342925 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (1R,2S,7R,8S)-5-but-3-en-1-ynyl-6,6-dimethoxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
| SMILES | C=CC#CC1=CC(=O)[C@@H]2[C@@H]([C@@H]3C=C[C@H]2C3)C1(OC)OC |
| InChI | InChI=1S/C17H18O3/c1-4-5-6-13-10-14(18)15-11-7-8-12(9-11)16(15)17(13,19-2)20-3/h4,7-8,10-12,15-16H,1,9H2,2-3H3/t11-,12+,15+,16+/m0/s1 |
| InChIKey | AOBVVWMGVSJMNE-UAXWRAGISA-N |
| XLogP | 2.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|