C18H20O3 — CID 53343688
(1R,2S,7R,8S)-6,6-dimethoxy-5-(3-methylbut-3-en-1-ynyl)tricyclo[6.2.1.02,7]undeca-4,9-dien-3-one (PubChem CID 53343688) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (1R,2S,7R,8S)-6,6-dimethoxy-5-(3-methylbut-3-en-1-ynyl)tricyclo[6.2.1.02,7]undeca-4,9-dien-3-one.
| Compound Name | (1R,2S,7R,8S)-6,6-dimethoxy-5-(3-methylbut-3-en-1-ynyl)tricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
|---|---|
| PubChem CID | 53343688 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (1R,2S,7R,8S)-6,6-dimethoxy-5-(3-methylbut-3-en-1-ynyl)tricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
| SMILES | C=C(C)C#CC1=CC(=O)[C@@H]2[C@@H]([C@@H]3C=C[C@H]2C3)C1(OC)OC |
| InChI | InChI=1S/C18H20O3/c1-11(2)5-8-14-10-15(19)16-12-6-7-13(9-12)17(16)18(14,20-3)21-4/h6-7,10,12-13,16-17H,1,9H2,2-4H3/t12-,13+,16+,17+/m0/s1 |
| InChIKey | GSYGKUQDGRUZAG-NSNWQYSKSA-N |
| XLogP | 2.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|