C22H30FNO — CID 53343018
(3R,4S)-4-(dibenzylamino)-2-fluoro-2,5-dimethylhexan-3-ol (PubChem CID 53343018) has the molecular formula C22H30FNO and a molecular weight of 343.49 g/mol. Its IUPAC name is (3R,4S)-4-(dibenzylamino)-2-fluoro-2,5-dimethylhexan-3-ol.
| Compound Name | (3R,4S)-4-(dibenzylamino)-2-fluoro-2,5-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 53343018 |
| Molecular Formula | C22H30FNO |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (3R,4S)-4-(dibenzylamino)-2-fluoro-2,5-dimethylhexan-3-ol |
| SMILES | CC(C)[C@@H]([C@@H](O)C(C)(C)F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H30FNO/c1-17(2)20(21(25)22(3,4)23)24(15-18-11-7-5-8-12-18)16-19-13-9-6-10-14-19/h5-14,17,20-21,25H,15-16H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | HUHPIUKLVKZPTC-LEWJYISDSA-N |
| XLogP | 4.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |