About N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide
N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide (PubChem CID 53346510) has the molecular formula C23H23N5O3S
and a molecular weight of 449.54 g/mol. Its IUPAC name is N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide |
| PubChem CID | 53346510 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide |
| SMILES | CCOc1ccc(-c2cccc(NS(C)(=O)=O)c2)cc1-c1ccc2c(N)nc(N)nc2c1 |
| InChI | InChI=1S/C23H23N5O3S/c1-3-31-21-10-8-15(14-5-4-6-17(11-14)28-32(2,29)30)12-19(21)16-7-9-18-20(13-16)26-23(25)27-22(18)24/h4-13,28H,3H2,1-2H3,(H4,24,25,26,27) |
| InChIKey | KBZJKRXRDPRBNM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide?
The IUPAC name of N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide (CID 53346510) is N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide is CCOc1ccc(-c2cccc(NS(C)(=O)=O)c2)cc1-c1ccc2c(N)nc(N)nc2c1.
What is the InChIKey of N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide?
The InChIKey is KBZJKRXRDPRBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N5O3S/c1-3-31-21-10-8-15(14-5-4-6-17(11-14)28-32(2,29)30)12-19(21)16-7-9-18-20(13-16)26-23(25)27-22(18)24/h4-13,28H,3H2,1-2H3,(H4,24,25,26,27).
What are the key properties of N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide?
N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide has a molecular weight of 449.54 g/mol, XLogP of 3.90, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide is sourced from PubChem (CID 53346510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).