C23H23N5O3S — CID 53346510
N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide (PubChem CID 53346510) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 53346510 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[3-[3-(2,4-diaminoquinazolin-7-yl)-4-ethoxyphenyl]phenyl]methanesulfonamide |
| SMILES | CCOc1ccc(-c2cccc(NS(C)(=O)=O)c2)cc1-c1ccc2c(N)nc(N)nc2c1 |
| InChI | InChI=1S/C23H23N5O3S/c1-3-31-21-10-8-15(14-5-4-6-17(11-14)28-32(2,29)30)12-19(21)16-7-9-18-20(13-16)26-23(25)27-22(18)24/h4-13,28H,3H2,1-2H3,(H4,24,25,26,27) |
| InChIKey | KBZJKRXRDPRBNM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |