C17H17ClN4O — CID 56659281
7-(5-chloro-2-ethoxyphenyl)-6-methylquinazoline-2,4-diamine (PubChem CID 56659281) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 7-(5-chloro-2-ethoxyphenyl)-6-methylquinazoline-2,4-diamine.
| Compound Name | 7-(5-chloro-2-ethoxyphenyl)-6-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 56659281 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 7-(5-chloro-2-ethoxyphenyl)-6-methylquinazoline-2,4-diamine |
| SMILES | CCOc1ccc(Cl)cc1-c1cc2nc(N)nc(N)c2cc1C |
| InChI | InChI=1S/C17H17ClN4O/c1-3-23-15-5-4-10(18)7-12(15)11-8-14-13(6-9(11)2)16(19)22-17(20)21-14/h4-8H,3H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | CDDUFXDZAGJSTL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |