C24H21N3OS — CID 53348139
N-(2-imidazol-1-yl-2-phenylethyl)-3-phenylsulfanylbenzamide (PubChem CID 53348139) has the molecular formula C24H21N3OS and a molecular weight of 399.52 g/mol. Its IUPAC name is N-(2-imidazol-1-yl-2-phenylethyl)-3-phenylsulfanylbenzamide.
| Compound Name | N-(2-imidazol-1-yl-2-phenylethyl)-3-phenylsulfanylbenzamide |
|---|---|
| PubChem CID | 53348139 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(2-imidazol-1-yl-2-phenylethyl)-3-phenylsulfanylbenzamide |
| SMILES | O=C(NCC(c1ccccc1)n1ccnc1)c1cccc(Sc2ccccc2)c1 |
| InChI | InChI=1S/C24H21N3OS/c28-24(20-10-7-13-22(16-20)29-21-11-5-2-6-12-21)26-17-23(27-15-14-25-18-27)19-8-3-1-4-9-19/h1-16,18,23H,17H2,(H,26,28) |
| InChIKey | RHBIMTFFMFPBMJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |