C28H26ClN3O3 — CID 132576472
N-[2-(4-chlorophenyl)-2-imidazol-1-ylethyl]-4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]benzamide (PubChem CID 132576472) has the molecular formula C28H26ClN3O3 and a molecular weight of 487.99 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-imidazol-1-ylethyl]-4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]benzamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-imidazol-1-ylethyl]-4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]benzamide |
|---|---|
| PubChem CID | 132576472 |
| Molecular Formula | C28H26ClN3O3 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-imidazol-1-ylethyl]-4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]benzamide |
| SMILES | COc1cc(/C=C/c2ccc(C(=O)NCC(c3ccc(Cl)cc3)n3ccnc3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C28H26ClN3O3/c1-34-25-15-21(16-26(17-25)35-2)4-3-20-5-7-23(8-6-20)28(33)31-18-27(32-14-13-30-19-32)22-9-11-24(29)12-10-22/h3-17,19,27H,18H2,1-2H3,(H,31,33)/b4-3+ |
| InChIKey | LSEAJUAFNWJYTM-ONEGZZNKSA-N |
| XLogP | 5.74 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|