C27H27ClN4O2 — CID 53348142
4-(4-butoxyphenyl)-N-[1-(5-chloro-2-pyridinyl)-2-imidazol-1-ylethyl]benzamide (PubChem CID 53348142) has the molecular formula C27H27ClN4O2 and a molecular weight of 474.99 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-N-[1-(5-chloro-2-pyridinyl)-2-imidazol-1-ylethyl]benzamide.
| Compound Name | 4-(4-butoxyphenyl)-N-[1-(5-chloro-2-pyridinyl)-2-imidazol-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 53348142 |
| Molecular Formula | C27H27ClN4O2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4-(4-butoxyphenyl)-N-[1-(5-chloro-2-pyridinyl)-2-imidazol-1-ylethyl]benzamide |
| SMILES | CCCCOc1ccc(-c2ccc(C(=O)NC(Cn3ccnc3)c3ccc(Cl)cn3)cc2)cc1 |
| InChI | InChI=1S/C27H27ClN4O2/c1-2-3-16-34-24-11-8-21(9-12-24)20-4-6-22(7-5-20)27(33)31-26(18-32-15-14-29-19-32)25-13-10-23(28)17-30-25/h4-15,17,19,26H,2-3,16,18H2,1H3,(H,31,33) |
| InChIKey | LVAOSTBFDVCIOO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|