C18H30O3Si — CID 53348304
(1S,4R,5R,8R,10R)-5-[tert-butyl(dimethyl)silyl]oxy-11-oxotricyclo[6.2.1.04,10]undecane-1-carbaldehyde (PubChem CID 53348304) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is (1S,4R,5R,8R,10R)-5-[tert-butyl(dimethyl)silyl]oxy-11-oxotricyclo[6.2.1.04,10]undecane-1-carbaldehyde.
| Compound Name | (1S,4R,5R,8R,10R)-5-[tert-butyl(dimethyl)silyl]oxy-11-oxotricyclo[6.2.1.04,10]undecane-1-carbaldehyde |
|---|---|
| PubChem CID | 53348304 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (1S,4R,5R,8R,10R)-5-[tert-butyl(dimethyl)silyl]oxy-11-oxotricyclo[6.2.1.04,10]undecane-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@H]2C[C@@H]3[C@H]1CC[C@]3(C=O)C2=O |
| InChI | InChI=1S/C18H30O3Si/c1-17(2,3)22(4,5)21-15-7-6-12-10-14-13(15)8-9-18(14,11-19)16(12)20/h11-15H,6-10H2,1-5H3/t12-,13-,14-,15-,18-/m1/s1 |
| InChIKey | TYWAWMIRXQGMTC-VFCJXBEMSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|