C17H30O2Si — CID 53348305
(1S,4R,5R,8R,10R)-5-[tert-butyl(dimethyl)silyl]oxytricyclo[6.2.1.04,10]undecan-11-one (PubChem CID 53348305) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is (1S,4R,5R,8R,10R)-5-[tert-butyl(dimethyl)silyl]oxytricyclo[6.2.1.04,10]undecan-11-one.
| Compound Name | (1S,4R,5R,8R,10R)-5-[tert-butyl(dimethyl)silyl]oxytricyclo[6.2.1.04,10]undecan-11-one |
|---|---|
| PubChem CID | 53348305 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (1S,4R,5R,8R,10R)-5-[tert-butyl(dimethyl)silyl]oxytricyclo[6.2.1.04,10]undecan-11-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@H]2C[C@@H]3[C@H]1CC[C@@H]3C2=O |
| InChI | InChI=1S/C17H30O2Si/c1-17(2,3)20(4,5)19-15-9-6-11-10-14-12(15)7-8-13(14)16(11)18/h11-15H,6-10H2,1-5H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | DERNLXVCPWCSLG-UXXRCYHCSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|