C18H32O2Si — CID 11088148
(1S,2S,4S,5S,7S,9S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyltricyclo[5.4.0.02,9]undecan-11-one (PubChem CID 11088148) has the molecular formula C18H32O2Si and a molecular weight of 308.54 g/mol. Its IUPAC name is (1S,2S,4S,5S,7S,9S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyltricyclo[5.4.0.02,9]undecan-11-one.
| Compound Name | (1S,2S,4S,5S,7S,9S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyltricyclo[5.4.0.02,9]undecan-11-one |
|---|---|
| PubChem CID | 11088148 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (1S,2S,4S,5S,7S,9S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyltricyclo[5.4.0.02,9]undecan-11-one |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CC(=O)[C@H]2[C@@H](C3)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O2Si/c1-11-7-14-12-8-13(17(14)15(19)9-12)10-16(11)20-21(5,6)18(2,3)4/h11-14,16-17H,7-10H2,1-6H3/t11-,12-,13-,14-,16-,17-/m0/s1 |
| InChIKey | ZSQJSTNKHHZNPG-HHHJXDIYSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|