C21H40O3Si — CID 53349038
(1aS,3R,4S,4aR,7R,7aR,7bS)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-1a-propan-2-yl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-4-ol (PubChem CID 53349038) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (1aS,3R,4S,4aR,7R,7aR,7bS)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-1a-propan-2-yl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-4-ol.
| Compound Name | (1aS,3R,4S,4aR,7R,7aR,7bS)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-1a-propan-2-yl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-4-ol |
|---|---|
| PubChem CID | 53349038 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (1aS,3R,4S,4aR,7R,7aR,7bS)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-1a-propan-2-yl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-4-ol |
| SMILES | CC(C)[C@@]12C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@](C)(O)[C@@H]3CC[C@@H](C)[C@H]3[C@@H]1O2 |
| InChI | InChI=1S/C21H40O3Si/c1-13(2)21-12-16(24-25(8,9)19(4,5)6)20(7,22)15-11-10-14(3)17(15)18(21)23-21/h13-18,22H,10-12H2,1-9H3/t14-,15-,16-,17-,18+,20+,21+/m1/s1 |
| InChIKey | AKXTVZDTULKIQU-FFSPKELQSA-N |
| XLogP | 4.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|