C20H30O2 — CID 53349469
ethyl (1R,2R,9S,11R)-2,8-dimethyl-5-propan-2-yltricyclo[7.2.1.01,7]dodeca-5,7-diene-11-carboxylate (PubChem CID 53349469) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is ethyl (1R,2R,9S,11R)-2,8-dimethyl-5-propan-2-yltricyclo[7.2.1.01,7]dodeca-5,7-diene-11-carboxylate.
| Compound Name | ethyl (1R,2R,9S,11R)-2,8-dimethyl-5-propan-2-yltricyclo[7.2.1.01,7]dodeca-5,7-diene-11-carboxylate |
|---|---|
| PubChem CID | 53349469 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | ethyl (1R,2R,9S,11R)-2,8-dimethyl-5-propan-2-yltricyclo[7.2.1.01,7]dodeca-5,7-diene-11-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]2C[C@]13C(=C2C)C=C(C(C)C)CC[C@H]3C |
| InChI | InChI=1S/C20H30O2/c1-6-22-19(21)18-10-16-11-20(18)13(4)7-8-15(12(2)3)9-17(20)14(16)5/h9,12-13,16,18H,6-8,10-11H2,1-5H3/t13-,16+,18+,20+/m1/s1 |
| InChIKey | PQUHMWRBVCJQKX-BPODSCFKSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |