C28H26F2N2O2 — CID 53350151
N,N'-bis(4-fluorophenyl)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine (PubChem CID 53350151) has the molecular formula C28H26F2N2O2 and a molecular weight of 460.52 g/mol. Its IUPAC name is N,N'-bis(4-fluorophenyl)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(4-fluorophenyl)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 53350151 |
| Molecular Formula | C28H26F2N2O2 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N,N'-bis(4-fluorophenyl)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(Nc2ccc(F)cc2)C(Nc2ccc(F)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H26F2N2O2/c1-33-25-15-3-19(4-16-25)27(31-23-11-7-21(29)8-12-23)28(20-5-17-26(34-2)18-6-20)32-24-13-9-22(30)10-14-24/h3-18,27-28,31-32H,1-2H3 |
| InChIKey | CHFDKJZNEXPNBM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |