C18H27ClNO2- — CID 53351025
ethyl 4-[[(2-methylphenyl)methylamino]methyl]cyclohexane-1-carboxylate chloride (PubChem CID 53351025) has the molecular formula C18H27ClNO2- and a molecular weight of 324.87 g/mol. Its IUPAC name is ethyl 4-[[(2-methylphenyl)methylamino]methyl]cyclohexane-1-carboxylate chloride.
| Compound Name | ethyl 4-[[(2-methylphenyl)methylamino]methyl]cyclohexane-1-carboxylate chloride |
|---|---|
| PubChem CID | 53351025 |
| Molecular Formula | C18H27ClNO2- |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | ethyl 4-[[(2-methylphenyl)methylamino]methyl]cyclohexane-1-carboxylate chloride |
| SMILES | CCOC(=O)C1CCC(CNCc2ccccc2C)CC1.[Cl-] |
| InChI | InChI=1S/C18H27NO2.ClH/c1-3-21-18(20)16-10-8-15(9-11-16)12-19-13-17-7-5-4-6-14(17)2;/h4-7,15-16,19H,3,8-13H2,1-2H3;1H/p-1 |
| InChIKey | GWIDVSDCWKGDET-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |