C16H21ClF3N2O2- — CID 53351089
2-[cyclohexyl(methyl)amino]-N-[4-(trifluoromethoxy)phenyl]acetamide chloride (PubChem CID 53351089) has the molecular formula C16H21ClF3N2O2- and a molecular weight of 365.80 g/mol. Its IUPAC name is 2-[cyclohexyl(methyl)amino]-N-[4-(trifluoromethoxy)phenyl]acetamide chloride.
| Compound Name | 2-[cyclohexyl(methyl)amino]-N-[4-(trifluoromethoxy)phenyl]acetamide chloride |
|---|---|
| PubChem CID | 53351089 |
| Molecular Formula | C16H21ClF3N2O2- |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-[cyclohexyl(methyl)amino]-N-[4-(trifluoromethoxy)phenyl]acetamide chloride |
| SMILES | CN(CC(=O)Nc1ccc(OC(F)(F)F)cc1)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C16H21F3N2O2.ClH/c1-21(13-5-3-2-4-6-13)11-15(22)20-12-7-9-14(10-8-12)23-16(17,18)19;/h7-10,13H,2-6,11H2,1H3,(H,20,22);1H/p-1 |
| InChIKey | ACAPDIODIQRTFR-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |