C22H29F3N2O2S2 — CID 87047998
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] N,N-dicyclohexylcarbamodithioate (PubChem CID 87047998) has the molecular formula C22H29F3N2O2S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] N,N-dicyclohexylcarbamodithioate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] N,N-dicyclohexylcarbamodithioate |
|---|---|
| PubChem CID | 87047998 |
| Molecular Formula | C22H29F3N2O2S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] N,N-dicyclohexylcarbamodithioate |
| SMILES | O=C(CSC(=S)N(C1CCCCC1)C1CCCCC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H29F3N2O2S2/c23-22(24,25)29-19-13-11-16(12-14-19)26-20(28)15-31-21(30)27(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h11-14,17-18H,1-10,15H2,(H,26,28) |
| InChIKey | VSRGYESCSZTQJZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|