C24H26ClN4O3S- — CID 53351114
N-[3-(dimethylamino)propyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide chloride (PubChem CID 53351114) has the molecular formula C24H26ClN4O3S- and a molecular weight of 486.02 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide chloride.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide chloride |
|---|---|
| PubChem CID | 53351114 |
| Molecular Formula | C24H26ClN4O3S- |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide chloride |
| SMILES | Cc1cc(C)c2sc(N(CCCN(C)C)C(=O)CN3C(=O)c4ccccc4C3=O)nc2c1.[Cl-] |
| InChI | InChI=1S/C24H26N4O3S.ClH/c1-15-12-16(2)21-19(13-15)25-24(32-21)27(11-7-10-26(3)4)20(29)14-28-22(30)17-8-5-6-9-18(17)23(28)31;/h5-6,8-9,12-13H,7,10-11,14H2,1-4H3;1H/p-1 |
| InChIKey | IYXVOJRVSKTPOB-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|