C22H22N4O3S — CID 41343593
N-[2-(dimethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 41343593) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 41343593 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1cccc2sc(N(CCN(C)C)C(=O)CN3C(=O)c4ccccc4C3=O)nc12 |
| InChI | InChI=1S/C22H22N4O3S/c1-14-7-6-10-17-19(14)23-22(30-17)25(12-11-24(2)3)18(27)13-26-20(28)15-8-4-5-9-16(15)21(26)29/h4-10H,11-13H2,1-3H3 |
| InChIKey | QJMQJVQEJIIZDK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|