C24H16ClN3O3S — CID 41109848
N-benzyl-N-(4-chloro-1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 41109848) has the molecular formula C24H16ClN3O3S and a molecular weight of 461.93 g/mol. Its IUPAC name is N-benzyl-N-(4-chloro-1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-benzyl-N-(4-chloro-1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 41109848 |
| Molecular Formula | C24H16ClN3O3S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | N-benzyl-N-(4-chloro-1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N(Cc1ccccc1)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C24H16ClN3O3S/c25-18-11-6-12-19-21(18)26-24(32-19)27(13-15-7-2-1-3-8-15)20(29)14-28-22(30)16-9-4-5-10-17(16)23(28)31/h1-12H,13-14H2 |
| InChIKey | VEYTVVKUKXDPNG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|