C26H21N3O3S — CID 41109691
N-benzyl-2-(1,3-dioxoisoindol-2-yl)-N-(4-ethyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 41109691) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-benzyl-2-(1,3-dioxoisoindol-2-yl)-N-(4-ethyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | N-benzyl-2-(1,3-dioxoisoindol-2-yl)-N-(4-ethyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 41109691 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-benzyl-2-(1,3-dioxoisoindol-2-yl)-N-(4-ethyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCc1cccc2sc(N(Cc3ccccc3)C(=O)CN3C(=O)c4ccccc4C3=O)nc12 |
| InChI | InChI=1S/C26H21N3O3S/c1-2-18-11-8-14-21-23(18)27-26(33-21)28(15-17-9-4-3-5-10-17)22(30)16-29-24(31)19-12-6-7-13-20(19)25(29)32/h3-14H,2,15-16H2,1H3 |
| InChIKey | AFWVLBWUKFJVFZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|