C21H19FN4O3S — CID 41343839
N-[2-(dimethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(4-fluoro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 41343839) has the molecular formula C21H19FN4O3S and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(4-fluoro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(4-fluoro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 41343839 |
| Molecular Formula | C21H19FN4O3S |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(4-fluoro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CN(C)CCN(C(=O)CN1C(=O)c2ccccc2C1=O)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C21H19FN4O3S/c1-24(2)10-11-25(21-23-18-15(22)8-5-9-16(18)30-21)17(27)12-26-19(28)13-6-3-4-7-14(13)20(26)29/h3-9H,10-12H2,1-2H3 |
| InChIKey | UOULHVOQSOXRRU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|