C13H17ClN3O5- — CID 53351842
N-[(2-hydroxy-5-nitrophenyl)methyl]-2-morpholin-4-ylacetamide chloride (PubChem CID 53351842) has the molecular formula C13H17ClN3O5- and a molecular weight of 330.75 g/mol. Its IUPAC name is N-[(2-hydroxy-5-nitrophenyl)methyl]-2-morpholin-4-ylacetamide chloride.
| Compound Name | N-[(2-hydroxy-5-nitrophenyl)methyl]-2-morpholin-4-ylacetamide chloride |
|---|---|
| PubChem CID | 53351842 |
| Molecular Formula | C13H17ClN3O5- |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-[(2-hydroxy-5-nitrophenyl)methyl]-2-morpholin-4-ylacetamide chloride |
| SMILES | O=C(CN1CCOCC1)NCc1cc([N+](=O)[O-])ccc1O.[Cl-] |
| InChI | InChI=1S/C13H17N3O5.ClH/c17-12-2-1-11(16(19)20)7-10(12)8-14-13(18)9-15-3-5-21-6-4-15;/h1-2,7,17H,3-6,8-9H2,(H,14,18);1H/p-1 |
| InChIKey | HRTQVSQKGVGWAB-UHFFFAOYSA-M |
| XLogP | -2.75 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|